C11H14O5 — CID 122487297
1-O-methyl 4-O-[[(1S)-2-oxocyclopentyl]methyl] (E)-but-2-enedioate (PubChem CID 122487297) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-O-methyl 4-O-[[(1S)-2-oxocyclopentyl]methyl] (E)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[[(1S)-2-oxocyclopentyl]methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122487297 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-O-methyl 4-O-[[(1S)-2-oxocyclopentyl]methyl] (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OC[C@@H]1CCCC1=O |
| InChI | InChI=1S/C11H14O5/c1-15-10(13)5-6-11(14)16-7-8-3-2-4-9(8)12/h5-6,8H,2-4,7H2,1H3/b6-5+/t8-/m0/s1 |
| InChIKey | PUFUPUNYTCAUJJ-GJIOHYHPSA-N |
| XLogP | 0.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|