C12H16N2O5 — CID 122482418
1-O-methyl 4-O-[[(2S,5S)-5-methyl-6-methylidene-3-oxopiperazin-2-yl]methyl] (E)-but-2-enedioate (PubChem CID 122482418) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is 1-O-methyl 4-O-[[(2S,5S)-5-methyl-6-methylidene-3-oxopiperazin-2-yl]methyl] (E)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[[(2S,5S)-5-methyl-6-methylidene-3-oxopiperazin-2-yl]methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122482418 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-O-methyl 4-O-[[(2S,5S)-5-methyl-6-methylidene-3-oxopiperazin-2-yl]methyl] (E)-but-2-enedioate |
| SMILES | C=C1N[C@@H](COC(=O)/C=C/C(=O)OC)C(=O)N[C@H]1C |
| InChI | InChI=1S/C12H16N2O5/c1-7-8(2)14-12(17)9(13-7)6-19-11(16)5-4-10(15)18-3/h4-5,8-9,13H,1,6H2,2-3H3,(H,14,17)/b5-4+/t8-,9-/m0/s1 |
| InChIKey | QFGGHJZEZRJMBH-HXQNXIEXSA-N |
| XLogP | -0.75 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|