C15H20N2O6 — CID 145134583
4-O-cyclohexyl 1-O-[(3,6-dioxopiperazin-2-yl)methyl] (E)-but-2-enedioate (PubChem CID 145134583) has the molecular formula C15H20N2O6 and a molecular weight of 324.33 g/mol. Its IUPAC name is 4-O-cyclohexyl 1-O-[(3,6-dioxopiperazin-2-yl)methyl] (E)-but-2-enedioate.
| Compound Name | 4-O-cyclohexyl 1-O-[(3,6-dioxopiperazin-2-yl)methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 145134583 |
| Molecular Formula | C15H20N2O6 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-O-cyclohexyl 1-O-[(3,6-dioxopiperazin-2-yl)methyl] (E)-but-2-enedioate |
| SMILES | O=C1CNC(=O)C(COC(=O)/C=C/C(=O)OC2CCCCC2)N1 |
| InChI | InChI=1S/C15H20N2O6/c18-12-8-16-15(21)11(17-12)9-22-13(19)6-7-14(20)23-10-4-2-1-3-5-10/h6-7,10-11H,1-5,8-9H2,(H,16,21)(H,17,18)/b7-6+ |
| InChIKey | MTHRHGUAYWPSKT-VOTSOKGWSA-N |
| XLogP | -0.42 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|