C20H24N4O8 — CID 122482361
bis[[(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl] (E)-but-2-enedioate (PubChem CID 122482361) has the molecular formula C20H24N4O8 and a molecular weight of 448.43 g/mol. Its IUPAC name is bis[[(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl] (E)-but-2-enedioate.
| Compound Name | bis[[(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122482361 |
| Molecular Formula | C20H24N4O8 |
| Molecular Weight | 448.43 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | bis[[(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl] (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OC[C@@H]1NC(=O)[C@@H]2CCCN2C1=O)OC[C@@H]1NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C20H24N4O8/c25-15(31-9-11-19(29)23-7-1-3-13(23)17(27)21-11)5-6-16(26)32-10-12-20(30)24-8-2-4-14(24)18(28)22-12/h5-6,11-14H,1-4,7-10H2,(H,21,27)(H,22,28)/b6-5+/t11-,12-,13-,14-/m0/s1 |
| InChIKey | QVSPWRGPDVYIFO-TXNPXBIASA-N |
| XLogP | -2.39 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.43 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|