C11H18N4O2S — CID 58843266
3-[(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]propylthiourea (PubChem CID 58843266) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is 3-[(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]propylthiourea.
| Compound Name | 3-[(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]propylthiourea |
|---|---|
| PubChem CID | 58843266 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 3-[(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]propylthiourea |
| SMILES | NC(=S)NCCC[C@@H]1NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C11H18N4O2S/c12-11(18)13-5-1-3-7-10(17)15-6-2-4-8(15)9(16)14-7/h7-8H,1-6H2,(H,14,16)(H3,12,13,18)/t7-,8-/m0/s1 |
| InChIKey | XFCOMCMVFZBBEP-YUMQZZPRSA-N |
| XLogP | -0.91 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|