C28H46N6O6 — CID 101219153
(3R,6S,9S,15R,18S,21S)-3,15-dimethyl-6,18-bis(2-methylpropyl)-1,4,7,13,16,19-hexazatricyclo[19.3.0.09,13]tetracosane-2,5,8,14,17,20-hexone (PubChem CID 101219153) has the molecular formula C28H46N6O6 and a molecular weight of 562.71 g/mol. Its IUPAC name is (3R,6S,9S,15R,18S,21S)-3,15-dimethyl-6,18-bis(2-methylpropyl)-1,4,7,13,16,19-hexazatricyclo[19.3.0.09,13]tetracosane-2,5,8,14,17,20-hexone.
| Compound Name | (3R,6S,9S,15R,18S,21S)-3,15-dimethyl-6,18-bis(2-methylpropyl)-1,4,7,13,16,19-hexazatricyclo[19.3.0.09,13]tetracosane-2,5,8,14,17,20-hexone |
|---|---|
| PubChem CID | 101219153 |
| Molecular Formula | C28H46N6O6 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | (3R,6S,9S,15R,18S,21S)-3,15-dimethyl-6,18-bis(2-methylpropyl)-1,4,7,13,16,19-hexazatricyclo[19.3.0.09,13]tetracosane-2,5,8,14,17,20-hexone |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](C)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](C)NC1=O |
| InChI | InChI=1S/C28H46N6O6/c1-15(2)13-19-23(35)29-17(5)27(39)34-12-8-10-22(34)26(38)32-20(14-16(3)4)24(36)30-18(6)28(40)33-11-7-9-21(33)25(37)31-19/h15-22H,7-14H2,1-6H3,(H,29,35)(H,30,36)(H,31,37)(H,32,38)/t17-,18-,19+,20+,21+,22+/m1/s1 |
| InChIKey | AGZMOEVEZDVXTI-PQQZDNAISA-N |
| XLogP | 0.05 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |