C25H40N6O9 — CID 10144539
2-[(3S,6S,9S,12S,15S,18R)-9-[(1R)-1-hydroxyethyl]-3,6-dimethyl-15-(2-methylpropyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-12-yl]acetic acid (PubChem CID 10144539) has the molecular formula C25H40N6O9 and a molecular weight of 568.63 g/mol. Its IUPAC name is 2-[(3S,6S,9S,12S,15S,18R)-9-[(1R)-1-hydroxyethyl]-3,6-dimethyl-15-(2-methylpropyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-12-yl]acetic acid.
| Compound Name | 2-[(3S,6S,9S,12S,15S,18R)-9-[(1R)-1-hydroxyethyl]-3,6-dimethyl-15-(2-methylpropyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-12-yl]acetic acid |
|---|---|
| PubChem CID | 10144539 |
| Molecular Formula | C25H40N6O9 |
| Molecular Weight | 568.63 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 2-[(3S,6S,9S,12S,15S,18R)-9-[(1R)-1-hydroxyethyl]-3,6-dimethyl-15-(2-methylpropyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-12-yl]acetic acid |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H]2CCCN2C(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@H]([C@@H](C)O)NC(=O)[C@H](CC(=O)O)NC1=O |
| InChI | InChI=1S/C25H40N6O9/c1-11(2)9-15-21(36)28-16(10-18(33)34)22(37)30-19(14(5)32)24(39)26-12(3)20(35)27-13(4)25(40)31-8-6-7-17(31)23(38)29-15/h11-17,19,32H,6-10H2,1-5H3,(H,26,39)(H,27,35)(H,28,36)(H,29,38)(H,30,37)(H,33,34)/t12-,13-,14+,15-,16-,17+,19-/m0/s1 |
| InChIKey | OCVAMZHVXPGJHM-IOBMDTMUSA-N |
| XLogP | -2.64 |
| TPSA | 223.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.63 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |