C16H18ClN3O4 — CID 166249207
[(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl 2-(6-chloro-2-methyl-3-pyridinyl)acetate (PubChem CID 166249207) has the molecular formula C16H18ClN3O4 and a molecular weight of 351.79 g/mol. Its IUPAC name is [(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl 2-(6-chloro-2-methyl-3-pyridinyl)acetate.
| Compound Name | [(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl 2-(6-chloro-2-methyl-3-pyridinyl)acetate |
|---|---|
| PubChem CID | 166249207 |
| Molecular Formula | C16H18ClN3O4 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | [(3S,8aS)-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl 2-(6-chloro-2-methyl-3-pyridinyl)acetate |
| SMILES | Cc1nc(Cl)ccc1CC(=O)OC[C@@H]1NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C16H18ClN3O4/c1-9-10(4-5-13(17)18-9)7-14(21)24-8-11-16(23)20-6-2-3-12(20)15(22)19-11/h4-5,11-12H,2-3,6-8H2,1H3,(H,19,22)/t11-,12-/m0/s1 |
| InChIKey | ZQIFPDDWRXMQCS-RYUDHWBXSA-N |
| XLogP | 0.62 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|