C12H16N2O6 — CID 122482095
1-O-[(1-methyl-2,5-dioxoimidazolidin-4-yl)methyl] 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 122482095) has the molecular formula C12H16N2O6 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1-O-[(1-methyl-2,5-dioxoimidazolidin-4-yl)methyl] 4-O-propan-2-yl (E)-but-2-enedioate.
| Compound Name | 1-O-[(1-methyl-2,5-dioxoimidazolidin-4-yl)methyl] 4-O-propan-2-yl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 122482095 |
| Molecular Formula | C12H16N2O6 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-O-[(1-methyl-2,5-dioxoimidazolidin-4-yl)methyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | CC(C)OC(=O)/C=C/C(=O)OCC1NC(=O)N(C)C1=O |
| InChI | InChI=1S/C12H16N2O6/c1-7(2)20-10(16)5-4-9(15)19-6-8-11(17)14(3)12(18)13-8/h4-5,7-8H,6H2,1-3H3,(H,13,18)/b5-4+ |
| InChIKey | UCALTVNOXUCLPF-SNAWJCMRSA-N |
| XLogP | -0.41 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|