C17H24O4 — CID 10803582
1-O-methyl 4-O-[[(1R,2S)-2-[(1E,3E)-penta-1,3-dienyl]cyclohexyl]methyl] (Z)-but-2-enedioate (PubChem CID 10803582) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-O-methyl 4-O-[[(1R,2S)-2-[(1E,3E)-penta-1,3-dienyl]cyclohexyl]methyl] (Z)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[[(1R,2S)-2-[(1E,3E)-penta-1,3-dienyl]cyclohexyl]methyl] (Z)-but-2-enedioate |
|---|---|
| PubChem CID | 10803582 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-O-methyl 4-O-[[(1R,2S)-2-[(1E,3E)-penta-1,3-dienyl]cyclohexyl]methyl] (Z)-but-2-enedioate |
| SMILES | C/C=C/C=C/[C@@H]1CCCC[C@H]1COC(=O)/C=C\C(=O)OC |
| InChI | InChI=1S/C17H24O4/c1-3-4-5-8-14-9-6-7-10-15(14)13-21-17(19)12-11-16(18)20-2/h3-5,8,11-12,14-15H,6-7,9-10,13H2,1-2H3/b4-3+,8-5+,12-11-/t14-,15+/m1/s1 |
| InChIKey | ZKGOCQNQYLLNDU-LFNOLKQCSA-N |
| XLogP | 3.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|