C28H46N2O10 — CID 158699616
1-O-methyl 4-O-(5-morpholin-4-ylpentyl) but-2-enedioate;2-methyl-3-(5-morpholin-4-ylpentyl)but-2-enedioic acid (PubChem CID 158699616) has the molecular formula C28H46N2O10 and a molecular weight of 570.68 g/mol. Its IUPAC name is 1-O-methyl 4-O-(5-morpholin-4-ylpentyl) but-2-enedioate;2-methyl-3-(5-morpholin-4-ylpentyl)but-2-enedioic acid.
| Compound Name | 1-O-methyl 4-O-(5-morpholin-4-ylpentyl) but-2-enedioate;2-methyl-3-(5-morpholin-4-ylpentyl)but-2-enedioic acid |
|---|---|
| PubChem CID | 158699616 |
| Molecular Formula | C28H46N2O10 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | 1-O-methyl 4-O-(5-morpholin-4-ylpentyl) but-2-enedioate;2-methyl-3-(5-morpholin-4-ylpentyl)but-2-enedioic acid |
| SMILES | CC(C(=O)O)=C(CCCCCN1CCOCC1)C(=O)O.COC(=O)C=CC(=O)OCCCCCN1CCOCC1 |
| InChI | InChI=1S/2C14H23NO5/c1-18-13(16)5-6-14(17)20-10-4-2-3-7-15-8-11-19-12-9-15;1-11(13(16)17)12(14(18)19)5-3-2-4-6-15-7-9-20-10-8-15/h5-6H,2-4,7-12H2,1H3;2-10H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | IHJJIWMNUIAROF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|