C17H29NO5 — CID 154077710
2-(6-morpholin-4-ylhexyl)-3-propan-2-ylbut-2-enedioic acid (PubChem CID 154077710) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-(6-morpholin-4-ylhexyl)-3-propan-2-ylbut-2-enedioic acid.
| Compound Name | 2-(6-morpholin-4-ylhexyl)-3-propan-2-ylbut-2-enedioic acid |
|---|---|
| PubChem CID | 154077710 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 2-(6-morpholin-4-ylhexyl)-3-propan-2-ylbut-2-enedioic acid |
| SMILES | CC(C)C(C(=O)O)=C(CCCCCCN1CCOCC1)C(=O)O |
| InChI | InChI=1S/C17H29NO5/c1-13(2)15(17(21)22)14(16(19)20)7-5-3-4-6-8-18-9-11-23-12-10-18/h13H,3-12H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | WLVHBOXZIZSEHK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|