C16H27NO5 — CID 154077832
2-(2,3-dimethylbutyl)-3-(2-morpholin-4-ylethyl)but-2-enedioic acid (PubChem CID 154077832) has the molecular formula C16H27NO5 and a molecular weight of 313.39 g/mol. Its IUPAC name is 2-(2,3-dimethylbutyl)-3-(2-morpholin-4-ylethyl)but-2-enedioic acid.
| Compound Name | 2-(2,3-dimethylbutyl)-3-(2-morpholin-4-ylethyl)but-2-enedioic acid |
|---|---|
| PubChem CID | 154077832 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-(2,3-dimethylbutyl)-3-(2-morpholin-4-ylethyl)but-2-enedioic acid |
| SMILES | CC(C)C(C)CC(C(=O)O)=C(CCN1CCOCC1)C(=O)O |
| InChI | InChI=1S/C16H27NO5/c1-11(2)12(3)10-14(16(20)21)13(15(18)19)4-5-17-6-8-22-9-7-17/h11-12H,4-10H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | HRRCAQUKGVVJGY-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|