C10H13F2N5O3 — CID 168886419
2-amino-9-(2,3-difluoro-4-hydroxy-3-methoxybutyl)-1H-purin-6-one (PubChem CID 168886419) has the molecular formula C10H13F2N5O3 and a molecular weight of 289.24 g/mol. Its IUPAC name is 2-amino-9-(2,3-difluoro-4-hydroxy-3-methoxybutyl)-1H-purin-6-one.
| Compound Name | 2-amino-9-(2,3-difluoro-4-hydroxy-3-methoxybutyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 168886419 |
| Molecular Formula | C10H13F2N5O3 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-amino-9-(2,3-difluoro-4-hydroxy-3-methoxybutyl)-1H-purin-6-one |
| SMILES | COC(F)(CO)C(F)Cn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H13F2N5O3/c1-20-10(12,3-18)5(11)2-17-4-14-6-7(17)15-9(13)16-8(6)19/h4-5,18H,2-3H2,1H3,(H3,13,15,16,19) |
| InChIKey | HHCYWFNLZUMHRG-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |