C11H17N5O4 — CID 135480731
2-amino-9-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]oxymethyl]-1H-purin-6-one (PubChem CID 135480731) has the molecular formula C11H17N5O4 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-amino-9-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]oxymethyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]oxymethyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135480731 |
| Molecular Formula | C11H17N5O4 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-amino-9-[[1-hydroxy-2-(hydroxymethyl)butan-2-yl]oxymethyl]-1H-purin-6-one |
| SMILES | CCC(CO)(CO)OCn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C11H17N5O4/c1-2-11(3-17,4-18)20-6-16-5-13-7-8(16)14-10(12)15-9(7)19/h5,17-18H,2-4,6H2,1H3,(H3,12,14,15,19) |
| InChIKey | ZXGSFVGOIMOHIH-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |