C9H14N6O — CID 123136405
6-ethoxy-9-N-ethylpurine-2,9-diamine (PubChem CID 123136405) has the molecular formula C9H14N6O and a molecular weight of 222.25 g/mol. Its IUPAC name is 6-ethoxy-9-N-ethylpurine-2,9-diamine.
| Compound Name | 6-ethoxy-9-N-ethylpurine-2,9-diamine |
|---|---|
| PubChem CID | 123136405 |
| Molecular Formula | C9H14N6O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 6-ethoxy-9-N-ethylpurine-2,9-diamine |
| SMILES | CCNn1cnc2c(OCC)nc(N)nc21 |
| InChI | InChI=1S/C9H14N6O/c1-3-12-15-5-11-6-7(15)13-9(10)14-8(6)16-4-2/h5,12H,3-4H2,1-2H3,(H2,10,13,14) |
| InChIKey | DPIRRWMTZZRUJR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |