C7H11N7 — CID 166965678
9-(1-aminoethyl)purine-2,6-diamine (PubChem CID 166965678) has the molecular formula C7H11N7 and a molecular weight of 193.21 g/mol. Its IUPAC name is 9-(1-aminoethyl)purine-2,6-diamine.
| Compound Name | 9-(1-aminoethyl)purine-2,6-diamine |
|---|---|
| PubChem CID | 166965678 |
| Molecular Formula | C7H11N7 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 9-(1-aminoethyl)purine-2,6-diamine |
| SMILES | CC(N)n1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C7H11N7/c1-3(8)14-2-11-4-5(9)12-7(10)13-6(4)14/h2-3H,8H2,1H3,(H4,9,10,12,13) |
| InChIKey | UTAGHHJLUUEMFH-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 121.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |