C9H10N6O3 — CID 141223619
[4-(2,6-diaminopurin-9-yl)-1,3-dioxol-2-yl]methanol (PubChem CID 141223619) has the molecular formula C9H10N6O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is [4-(2,6-diaminopurin-9-yl)-1,3-dioxol-2-yl]methanol.
| Compound Name | [4-(2,6-diaminopurin-9-yl)-1,3-dioxol-2-yl]methanol |
|---|---|
| PubChem CID | 141223619 |
| Molecular Formula | C9H10N6O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | [4-(2,6-diaminopurin-9-yl)-1,3-dioxol-2-yl]methanol |
| SMILES | Nc1nc(N)c2ncn(C3=COC(CO)O3)c2n1 |
| InChI | InChI=1S/C9H10N6O3/c10-7-6-8(14-9(11)13-7)15(3-12-6)4-2-17-5(1-16)18-4/h2-3,5,16H,1H2,(H4,10,11,13,14) |
| InChIKey | LREGVMICXALMQR-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |