C19H17N5S — CID 18332690
9-benzyl-2-(4-methylphenyl)sulfanylpurin-6-amine (PubChem CID 18332690) has the molecular formula C19H17N5S and a molecular weight of 347.45 g/mol. Its IUPAC name is 9-benzyl-2-(4-methylphenyl)sulfanylpurin-6-amine.
| Compound Name | 9-benzyl-2-(4-methylphenyl)sulfanylpurin-6-amine |
|---|---|
| PubChem CID | 18332690 |
| Molecular Formula | C19H17N5S |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 9-benzyl-2-(4-methylphenyl)sulfanylpurin-6-amine |
| SMILES | Cc1ccc(Sc2nc(N)c3ncn(Cc4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C19H17N5S/c1-13-7-9-15(10-8-13)25-19-22-17(20)16-18(23-19)24(12-21-16)11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H2,20,22,23) |
| InChIKey | MMVFDEABFVUHOU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |