C23H25N5OS — CID 69336132
9-[2-(4-methoxyphenyl)ethyl]-2-(3-phenylpropylsulfanyl)purin-6-amine (PubChem CID 69336132) has the molecular formula C23H25N5OS and a molecular weight of 419.55 g/mol. Its IUPAC name is 9-[2-(4-methoxyphenyl)ethyl]-2-(3-phenylpropylsulfanyl)purin-6-amine.
| Compound Name | 9-[2-(4-methoxyphenyl)ethyl]-2-(3-phenylpropylsulfanyl)purin-6-amine |
|---|---|
| PubChem CID | 69336132 |
| Molecular Formula | C23H25N5OS |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 9-[2-(4-methoxyphenyl)ethyl]-2-(3-phenylpropylsulfanyl)purin-6-amine |
| SMILES | COc1ccc(CCn2cnc3c(N)nc(SCCCc4ccccc4)nc32)cc1 |
| InChI | InChI=1S/C23H25N5OS/c1-29-19-11-9-18(10-12-19)13-14-28-16-25-20-21(24)26-23(27-22(20)28)30-15-5-8-17-6-3-2-4-7-17/h2-4,6-7,9-12,16H,5,8,13-15H2,1H3,(H2,24,26,27) |
| InChIKey | DZYMVIKBFXBUBO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|