C23H24BrN5OS — CID 18440560
8-bromo-N-ethyl-9-(4-methoxyphenyl)-2-(3-phenylpropylsulfanyl)purin-6-amine (PubChem CID 18440560) has the molecular formula C23H24BrN5OS and a molecular weight of 498.45 g/mol. Its IUPAC name is 8-bromo-N-ethyl-9-(4-methoxyphenyl)-2-(3-phenylpropylsulfanyl)purin-6-amine.
| Compound Name | 8-bromo-N-ethyl-9-(4-methoxyphenyl)-2-(3-phenylpropylsulfanyl)purin-6-amine |
|---|---|
| PubChem CID | 18440560 |
| Molecular Formula | C23H24BrN5OS |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | 8-bromo-N-ethyl-9-(4-methoxyphenyl)-2-(3-phenylpropylsulfanyl)purin-6-amine |
| SMILES | CCNc1nc(SCCCc2ccccc2)nc2c1nc(Br)n2-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H24BrN5OS/c1-3-25-20-19-21(29(22(24)26-19)17-11-13-18(30-2)14-12-17)28-23(27-20)31-15-7-10-16-8-5-4-6-9-16/h4-6,8-9,11-14H,3,7,10,15H2,1-2H3,(H,25,27,28) |
| InChIKey | FUGRUXHBALQVCY-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|