C22H22BrN5S — CID 18440570
8-bromo-N-ethyl-9-phenyl-2-(3-phenylpropylsulfanyl)purin-6-amine (PubChem CID 18440570) has the molecular formula C22H22BrN5S and a molecular weight of 468.42 g/mol. Its IUPAC name is 8-bromo-N-ethyl-9-phenyl-2-(3-phenylpropylsulfanyl)purin-6-amine.
| Compound Name | 8-bromo-N-ethyl-9-phenyl-2-(3-phenylpropylsulfanyl)purin-6-amine |
|---|---|
| PubChem CID | 18440570 |
| Molecular Formula | C22H22BrN5S |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 8-bromo-N-ethyl-9-phenyl-2-(3-phenylpropylsulfanyl)purin-6-amine |
| SMILES | CCNc1nc(SCCCc2ccccc2)nc2c1nc(Br)n2-c1ccccc1 |
| InChI | InChI=1S/C22H22BrN5S/c1-2-24-19-18-20(28(21(23)25-18)17-13-7-4-8-14-17)27-22(26-19)29-15-9-12-16-10-5-3-6-11-16/h3-8,10-11,13-14H,2,9,12,15H2,1H3,(H,24,26,27) |
| InChIKey | YTIPKSHPSVLANG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|