C28H26IN7OS3 — CID 17337364
2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17337364) has the molecular formula C28H26IN7OS3 and a molecular weight of 699.67 g/mol. Its IUPAC name is 2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17337364 |
| Molecular Formula | C28H26IN7OS3 |
| Molecular Weight | 699.67 g/mol |
| Exact Mass | 699.04 |
| IUPAC Name | 2-[[5-[(4-iodoanilino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(CSc1nnc(CNc2ccc(I)cc2)n1-c1ccccc1)Nc1nnc(SCCCc2ccccc2)s1 |
| InChI | InChI=1S/C28H26IN7OS3/c29-21-13-15-22(16-14-21)30-18-24-32-34-27(36(24)23-11-5-2-6-12-23)39-19-25(37)31-26-33-35-28(40-26)38-17-7-10-20-8-3-1-4-9-20/h1-6,8-9,11-16,30H,7,10,17-19H2,(H,31,33,37) |
| InChIKey | FUAFTQVHZMLMNR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|