C19H18BrN3OS2 — CID 17320539
2-(4-bromophenyl)-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 17320539) has the molecular formula C19H18BrN3OS2 and a molecular weight of 448.41 g/mol. Its IUPAC name is 2-(4-bromophenyl)-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(4-bromophenyl)-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17320539 |
| Molecular Formula | C19H18BrN3OS2 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 447.01 |
| IUPAC Name | 2-(4-bromophenyl)-N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Cc1ccc(Br)cc1)Nc1nnc(SCCCc2ccccc2)s1 |
| InChI | InChI=1S/C19H18BrN3OS2/c20-16-10-8-15(9-11-16)13-17(24)21-18-22-23-19(26-18)25-12-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-11H,4,7,12-13H2,(H,21,22,24) |
| InChIKey | XTFGFHUZRPSJPY-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|