C21H23N3OS3 — CID 17321823
N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-propylsulfanylbenzamide (PubChem CID 17321823) has the molecular formula C21H23N3OS3 and a molecular weight of 429.64 g/mol. Its IUPAC name is N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-propylsulfanylbenzamide.
| Compound Name | N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-propylsulfanylbenzamide |
|---|---|
| PubChem CID | 17321823 |
| Molecular Formula | C21H23N3OS3 |
| Molecular Weight | 429.64 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N-[5-(3-phenylpropylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-propylsulfanylbenzamide |
| SMILES | CCCSc1ccccc1C(=O)Nc1nnc(SCCCc2ccccc2)s1 |
| InChI | InChI=1S/C21H23N3OS3/c1-2-14-26-18-13-7-6-12-17(18)19(25)22-20-23-24-21(28-20)27-15-8-11-16-9-4-3-5-10-16/h3-7,9-10,12-13H,2,8,11,14-15H2,1H3,(H,22,23,25) |
| InChIKey | RLBCDYOXXJUIJT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.64 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|