C17H18N6OS3 — CID 17137269
2-[(5-ethyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 17137269) has the molecular formula C17H18N6OS3 and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-[(5-ethyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(5-ethyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 17137269 |
| Molecular Formula | C17H18N6OS3 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-[(5-ethyl-4-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | C=CCSc1nnc(NC(=O)CSc2nnc(CC)n2-c2ccccc2)s1 |
| InChI | InChI=1S/C17H18N6OS3/c1-3-10-25-17-22-20-15(27-17)18-14(24)11-26-16-21-19-13(4-2)23(16)12-8-6-5-7-9-12/h3,5-9H,1,4,10-11H2,2H3,(H,18,20,24) |
| InChIKey | RTNDREIULRNACE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|