C12H12N4OS3 — CID 2968297
N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2-pyridin-2-ylsulfanylacetamide (PubChem CID 2968297) has the molecular formula C12H12N4OS3 and a molecular weight of 324.46 g/mol. Its IUPAC name is N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 2968297 |
| Molecular Formula | C12H12N4OS3 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2-pyridin-2-ylsulfanylacetamide |
| SMILES | C=CCSc1nnc(NC(=O)CSc2ccccn2)s1 |
| InChI | InChI=1S/C12H12N4OS3/c1-2-7-18-12-16-15-11(20-12)14-9(17)8-19-10-5-3-4-6-13-10/h2-6H,1,7-8H2,(H,14,15,17) |
| InChIKey | CTYVAXHEHSTSAN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|