C20H22N6O2S2 — CID 95744584
N-[1-(2-phenylethyl)pyrazol-4-yl]-N'-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanediamide (PubChem CID 95744584) has the molecular formula C20H22N6O2S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is N-[1-(2-phenylethyl)pyrazol-4-yl]-N'-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanediamide.
| Compound Name | N-[1-(2-phenylethyl)pyrazol-4-yl]-N'-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanediamide |
|---|---|
| PubChem CID | 95744584 |
| Molecular Formula | C20H22N6O2S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | N-[1-(2-phenylethyl)pyrazol-4-yl]-N'-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)butanediamide |
| SMILES | C=CCSc1nnc(NC(=O)CCC(=O)Nc2cnn(CCc3ccccc3)c2)s1 |
| InChI | InChI=1S/C20H22N6O2S2/c1-2-12-29-20-25-24-19(30-20)23-18(28)9-8-17(27)22-16-13-21-26(14-16)11-10-15-6-4-3-5-7-15/h2-7,13-14H,1,8-12H2,(H,22,27)(H,23,24,28) |
| InChIKey | XZAZJKRBJOGCFM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|