C9H10N6OS3 — CID 51370546
N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 51370546) has the molecular formula C9H10N6OS3 and a molecular weight of 314.42 g/mol. Its IUPAC name is N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 51370546 |
| Molecular Formula | C9H10N6OS3 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | C=CCSc1nnc(NC(=O)CSc2ncn[nH]2)s1 |
| InChI | InChI=1S/C9H10N6OS3/c1-2-3-17-9-15-14-8(19-9)12-6(16)4-18-7-10-5-11-13-7/h2,5H,1,3-4H2,(H,10,11,13)(H,12,14,16) |
| InChIKey | ANVJXXXJSHGEKT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|