C8H10N6OS3 — CID 9458211
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 9458211) has the molecular formula C8H10N6OS3 and a molecular weight of 302.41 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 9458211 |
| Molecular Formula | C8H10N6OS3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CSc2ncn[nH]2)s1 |
| InChI | InChI=1S/C8H10N6OS3/c1-2-16-8-14-13-7(18-8)11-5(15)3-17-6-9-4-10-12-6/h4H,2-3H2,1H3,(H,9,10,12)(H,11,13,15) |
| InChIKey | ANNVTRCHOITIQR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|