C8H10N4OS3 — CID 43068920
2-(cyanomethylsulfanyl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 43068920) has the molecular formula C8H10N4OS3 and a molecular weight of 274.40 g/mol. Its IUPAC name is 2-(cyanomethylsulfanyl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-(cyanomethylsulfanyl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 43068920 |
| Molecular Formula | C8H10N4OS3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 2-(cyanomethylsulfanyl)-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CSCC#N)s1 |
| InChI | InChI=1S/C8H10N4OS3/c1-2-15-8-12-11-7(16-8)10-6(13)5-14-4-3-9/h2,4-5H2,1H3,(H,10,11,13) |
| InChIKey | CRYFVWQFTXKWEB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|