C12H9ClN4OS2 — CID 47382764
N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-2-(cyanomethylsulfanyl)acetamide (PubChem CID 47382764) has the molecular formula C12H9ClN4OS2 and a molecular weight of 324.82 g/mol. Its IUPAC name is N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-2-(cyanomethylsulfanyl)acetamide.
| Compound Name | N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-2-(cyanomethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 47382764 |
| Molecular Formula | C12H9ClN4OS2 |
| Molecular Weight | 324.82 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]-2-(cyanomethylsulfanyl)acetamide |
| SMILES | N#CCSCC(=O)Nc1nnc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C12H9ClN4OS2/c13-9-4-2-1-3-8(9)11-16-17-12(20-11)15-10(18)7-19-6-5-14/h1-4H,6-7H2,(H,15,17,18) |
| InChIKey | NPRFXWIEQYAZIN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.82 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|