C9H4ClN3S — CID 164662938
5-(2-chlorophenyl)-1,3,4-thiadiazole-2-carbonitrile (PubChem CID 164662938) has the molecular formula C9H4ClN3S and a molecular weight of 221.67 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1,3,4-thiadiazole-2-carbonitrile.
| Compound Name | 5-(2-chlorophenyl)-1,3,4-thiadiazole-2-carbonitrile |
|---|---|
| PubChem CID | 164662938 |
| Molecular Formula | C9H4ClN3S |
| Molecular Weight | 221.67 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 5-(2-chlorophenyl)-1,3,4-thiadiazole-2-carbonitrile |
| SMILES | N#Cc1nnc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C9H4ClN3S/c10-7-4-2-1-3-6(7)9-13-12-8(5-11)14-9/h1-4H |
| InChIKey | YRAZNWYSPWJGTL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.67 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |