C18H8Cl2N4 — CID 132588447
5,6-bis(2-chlorophenyl)pyrazine-2,3-dicarbonitrile (PubChem CID 132588447) has the molecular formula C18H8Cl2N4 and a molecular weight of 351.20 g/mol. Its IUPAC name is 5,6-bis(2-chlorophenyl)pyrazine-2,3-dicarbonitrile.
| Compound Name | 5,6-bis(2-chlorophenyl)pyrazine-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 132588447 |
| Molecular Formula | C18H8Cl2N4 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 5,6-bis(2-chlorophenyl)pyrazine-2,3-dicarbonitrile |
| SMILES | N#Cc1nc(-c2ccccc2Cl)c(-c2ccccc2Cl)nc1C#N |
| InChI | InChI=1S/C18H8Cl2N4/c19-13-7-3-1-5-11(13)17-18(12-6-2-4-8-14(12)20)24-16(10-22)15(9-21)23-17/h1-8H |
| InChIKey | MJIXAVLNFHSWOJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |