C15H16N4OS3 — CID 4144657
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2-methyl-1H-indol-3-yl)sulfanyl]acetamide (PubChem CID 4144657) has the molecular formula C15H16N4OS3 and a molecular weight of 364.52 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2-methyl-1H-indol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2-methyl-1H-indol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4144657 |
| Molecular Formula | C15H16N4OS3 |
| Molecular Weight | 364.52 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[(2-methyl-1H-indol-3-yl)sulfanyl]acetamide |
| SMILES | CCSc1nnc(NC(=O)CSc2c(C)[nH]c3ccccc23)s1 |
| InChI | InChI=1S/C15H16N4OS3/c1-3-21-15-19-18-14(23-15)17-12(20)8-22-13-9(2)16-11-7-5-4-6-10(11)13/h4-7,16H,3,8H2,1-2H3,(H,17,18,20) |
| InChIKey | IOCHKASJTFBJDY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|