C14H14N4S — CID 52544189
2-(3-phenylpropylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 52544189) has the molecular formula C14H14N4S and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-(3-phenylpropylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-(3-phenylpropylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 52544189 |
| Molecular Formula | C14H14N4S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-(3-phenylpropylsulfanyl)-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | c1ccc(CCCSc2nc3ncccn3n2)cc1 |
| InChI | InChI=1S/C14H14N4S/c1-2-6-12(7-3-1)8-4-11-19-14-16-13-15-9-5-10-18(13)17-14/h1-3,5-7,9-10H,4,8,11H2 |
| InChIKey | GUORFNSYTIKJTG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|