C17H15N5O2S — CID 16580530
2-[4-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)butyl]isoindole-1,3-dione (PubChem CID 16580530) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is 2-[4-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 16580530 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-[4-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCSc1nc2ncccn2n1 |
| InChI | InChI=1S/C17H15N5O2S/c23-14-12-6-1-2-7-13(12)15(24)21(14)9-3-4-11-25-17-19-16-18-8-5-10-22(16)20-17/h1-2,5-8,10H,3-4,9,11H2 |
| InChIKey | MQLISWBPYHECDG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|