C13H11FN4OS — CID 47134889
2-[2-(2-fluorophenoxy)ethylsulfanyl]-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 47134889) has the molecular formula C13H11FN4OS and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[2-(2-fluorophenoxy)ethylsulfanyl]-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[2-(2-fluorophenoxy)ethylsulfanyl]-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 47134889 |
| Molecular Formula | C13H11FN4OS |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 2-[2-(2-fluorophenoxy)ethylsulfanyl]-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Fc1ccccc1OCCSc1nc2ncccn2n1 |
| InChI | InChI=1S/C13H11FN4OS/c14-10-4-1-2-5-11(10)19-8-9-20-13-16-12-15-6-3-7-18(12)17-13/h1-7H,8-9H2 |
| InChIKey | BITKABUNSFQUTR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|