C14H13ClN4OS — CID 76684684
2-[2-(4-chlorophenoxy)ethylsulfanyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 76684684) has the molecular formula C14H13ClN4OS and a molecular weight of 320.81 g/mol. Its IUPAC name is 2-[2-(4-chlorophenoxy)ethylsulfanyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 76684684 |
| Molecular Formula | C14H13ClN4OS |
| Molecular Weight | 320.81 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-[2-(4-chlorophenoxy)ethylsulfanyl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1ccn2nc(SCCOc3ccc(Cl)cc3)nc2n1 |
| InChI | InChI=1S/C14H13ClN4OS/c1-10-6-7-19-13(16-10)17-14(18-19)21-9-8-20-12-4-2-11(15)3-5-12/h2-7H,8-9H2,1H3 |
| InChIKey | WYAJJBDACRMJMK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|