C21H27N3O2 — CID 14662149
2-(10-pyrazol-1-yldecyl)isoindole-1,3-dione (PubChem CID 14662149) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-(10-pyrazol-1-yldecyl)isoindole-1,3-dione.
| Compound Name | 2-(10-pyrazol-1-yldecyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 14662149 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 2-(10-pyrazol-1-yldecyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCCCCCCCn1cccn1 |
| InChI | InChI=1S/C21H27N3O2/c25-20-18-12-7-8-13-19(18)21(26)24(20)17-10-6-4-2-1-3-5-9-15-23-16-11-14-22-23/h7-8,11-14,16H,1-6,9-10,15,17H2 |
| InChIKey | YLPYFHWUSCQMDF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|