C16H17N5OS — CID 37196826
N-(3-phenylpropyl)-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)acetamide (PubChem CID 37196826) has the molecular formula C16H17N5OS and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(3-phenylpropyl)-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)acetamide.
| Compound Name | N-(3-phenylpropyl)-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 37196826 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-(3-phenylpropyl)-2-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanyl)acetamide |
| SMILES | O=C(CSc1nc2ncccn2n1)NCCCc1ccccc1 |
| InChI | InChI=1S/C16H17N5OS/c22-14(17-9-4-8-13-6-2-1-3-7-13)12-23-16-19-15-18-10-5-11-21(15)20-16/h1-3,5-7,10-11H,4,8-9,12H2,(H,17,22) |
| InChIKey | NEBIQBPUVRBSSL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|