C20H19N3OS — CID 6487647
N-(2-phenylethyl)-2-(4-phenylpyrimidin-2-yl)sulfanylacetamide (PubChem CID 6487647) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is N-(2-phenylethyl)-2-(4-phenylpyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-phenylethyl)-2-(4-phenylpyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 6487647 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | N-(2-phenylethyl)-2-(4-phenylpyrimidin-2-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nccc(-c2ccccc2)n1)NCCc1ccccc1 |
| InChI | InChI=1S/C20H19N3OS/c24-19(21-13-11-16-7-3-1-4-8-16)15-25-20-22-14-12-18(23-20)17-9-5-2-6-10-17/h1-10,12,14H,11,13,15H2,(H,21,24) |
| InChIKey | JMMANUGLOHSQOC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |