C8H8N4S — CID 51111566
2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 51111566) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 51111566 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | C=CCSc1nc2ncccn2n1 |
| InChI | InChI=1S/C8H8N4S/c1-2-6-13-8-10-7-9-4-3-5-12(7)11-8/h2-5H,1,6H2 |
| InChIKey | VWSCSODPWSWSJT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|