About 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine
2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 51111566) has the molecular formula C8H8N4S
and a molecular weight of 192.25 g/mol. Its IUPAC name is 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| PubChem CID | 51111566 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | C=CCSc1nc2ncccn2n1 |
| InChI | InChI=1S/C8H8N4S/c1-2-6-13-8-10-7-9-4-3-5-12(7)11-8/h2-5H,1,6H2 |
| InChIKey | VWSCSODPWSWSJT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The IUPAC name of 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine (CID 51111566) is 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine.
What is the SMILES notation for 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The canonical SMILES for 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine is C=CCSc1nc2ncccn2n1.
What is the InChIKey of 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The InChIKey is VWSCSODPWSWSJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4S/c1-2-6-13-8-10-7-9-4-3-5-12(7)11-8/h2-5H,1,6H2.
What are the key properties of 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine?
2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine has a molecular weight of 192.25 g/mol, XLogP of 1.40, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylsulfanyl-[1,2,4]triazolo[1,5-a]pyrimidine is sourced from PubChem (CID 51111566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).