C15H14N6OS — CID 51108675
3-phenyl-6-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-5,6-dihydro-2H-1,2,4-oxadiazine (PubChem CID 51108675) has the molecular formula C15H14N6OS and a molecular weight of 326.38 g/mol. Its IUPAC name is 3-phenyl-6-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-5,6-dihydro-2H-1,2,4-oxadiazine.
| Compound Name | 3-phenyl-6-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-5,6-dihydro-2H-1,2,4-oxadiazine |
|---|---|
| PubChem CID | 51108675 |
| Molecular Formula | C15H14N6OS |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-phenyl-6-([1,2,4]triazolo[1,5-a]pyrimidin-2-ylsulfanylmethyl)-5,6-dihydro-2H-1,2,4-oxadiazine |
| SMILES | c1ccc(C2=NCC(CSc3nc4ncccn4n3)ON2)cc1 |
| InChI | InChI=1S/C15H14N6OS/c1-2-5-11(6-3-1)13-17-9-12(22-20-13)10-23-15-18-14-16-7-4-8-21(14)19-15/h1-8,12H,9-10H2,(H,17,20) |
| InChIKey | CBOXQQSYQUHSGV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |