C16H18N6O2S — CID 25222135
2-butylsulfanyl-9-[(2-nitrophenyl)methyl]purin-6-amine (PubChem CID 25222135) has the molecular formula C16H18N6O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is 2-butylsulfanyl-9-[(2-nitrophenyl)methyl]purin-6-amine.
| Compound Name | 2-butylsulfanyl-9-[(2-nitrophenyl)methyl]purin-6-amine |
|---|---|
| PubChem CID | 25222135 |
| Molecular Formula | C16H18N6O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-butylsulfanyl-9-[(2-nitrophenyl)methyl]purin-6-amine |
| SMILES | CCCCSc1nc(N)c2ncn(Cc3ccccc3[N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C16H18N6O2S/c1-2-3-8-25-16-19-14(17)13-15(20-16)21(10-18-13)9-11-6-4-5-7-12(11)22(23)24/h4-7,10H,2-3,8-9H2,1H3,(H2,17,19,20) |
| InChIKey | GBOXDYOWNOSXDP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|