C15H14N4O2S2 — CID 56563656
5,6-dimethyl-2-[(2-nitrophenyl)methylsulfanyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 56563656) has the molecular formula C15H14N4O2S2 and a molecular weight of 346.44 g/mol. Its IUPAC name is 5,6-dimethyl-2-[(2-nitrophenyl)methylsulfanyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 5,6-dimethyl-2-[(2-nitrophenyl)methylsulfanyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 56563656 |
| Molecular Formula | C15H14N4O2S2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 5,6-dimethyl-2-[(2-nitrophenyl)methylsulfanyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1sc2nc(SCc3ccccc3[N+](=O)[O-])nc(N)c2c1C |
| InChI | InChI=1S/C15H14N4O2S2/c1-8-9(2)23-14-12(8)13(16)17-15(18-14)22-7-10-5-3-4-6-11(10)19(20)21/h3-6H,7H2,1-2H3,(H2,16,17,18) |
| InChIKey | BDCANQXPFWFBRX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|