C16H20N6NaO2 — CID 159412447
CID 159412447 (PubChem CID 159412447) has the molecular formula C16H20N6NaO2 and a molecular weight of 351.37 g/mol.
| Compound Name | CID 159412447 |
|---|---|
| PubChem CID | 159412447 |
| Molecular Formula | C16H20N6NaO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | — |
| SMILES | CCCCOc1nc(N)c2ncn(Cc3ccc(OC)nc3)c2n1.[Na] |
| InChI | InChI=1S/C16H20N6O2.Na/c1-3-4-7-24-16-20-14(17)13-15(21-16)22(10-19-13)9-11-5-6-12(23-2)18-8-11;/h5-6,8,10H,3-4,7,9H2,1-2H3,(H2,17,20,21); |
| InChIKey | LOSZBSNCHSCYIW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|