About CID 159412447
CID 159412447 (PubChem CID 159412447) has the molecular formula C16H20N6NaO2
and a molecular weight of 351.37 g/mol.
Molecular Properties
| Compound Name | CID 159412447 |
| PubChem CID | 159412447 |
| Molecular Formula | C16H20N6NaO2 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | — |
| SMILES | CCCCOc1nc(N)c2ncn(Cc3ccc(OC)nc3)c2n1.[Na] |
| InChI | InChI=1S/C16H20N6O2.Na/c1-3-4-7-24-16-20-14(17)13-15(21-16)22(10-19-13)9-11-5-6-12(23-2)18-8-11;/h5-6,8,10H,3-4,7,9H2,1-2H3,(H2,17,20,21); |
| InChIKey | LOSZBSNCHSCYIW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 159412447 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159412447?
The IUPAC name of CID 159412447 (CID 159412447) is not available.
What is the SMILES notation for CID 159412447?
The canonical SMILES for CID 159412447 is CCCCOc1nc(N)c2ncn(Cc3ccc(OC)nc3)c2n1.[Na].
What is the InChIKey of CID 159412447?
The InChIKey is LOSZBSNCHSCYIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N6O2.Na/c1-3-4-7-24-16-20-14(17)13-15(21-16)22(10-19-13)9-11-5-6-12(23-2)18-8-11;/h5-6,8,10H,3-4,7,9H2,1-2H3,(H2,17,20,21);.
What are the key properties of CID 159412447?
CID 159412447 has a molecular weight of 351.37 g/mol, XLogP of 1.66, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159412447 is sourced from PubChem (CID 159412447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).