C17H29BrN5O6P — CID 87608083
2-[6-amino-8-bromo-2-(2-methoxyethoxy)purin-9-yl]ethoxymethyl-(2,3-dimethylbutan-2-yloxy)phosphinic acid (PubChem CID 87608083) has the molecular formula C17H29BrN5O6P and a molecular weight of 510.33 g/mol. Its IUPAC name is 2-[6-amino-8-bromo-2-(2-methoxyethoxy)purin-9-yl]ethoxymethyl-(2,3-dimethylbutan-2-yloxy)phosphinic acid.
| Compound Name | 2-[6-amino-8-bromo-2-(2-methoxyethoxy)purin-9-yl]ethoxymethyl-(2,3-dimethylbutan-2-yloxy)phosphinic acid |
|---|---|
| PubChem CID | 87608083 |
| Molecular Formula | C17H29BrN5O6P |
| Molecular Weight | 510.33 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | 2-[6-amino-8-bromo-2-(2-methoxyethoxy)purin-9-yl]ethoxymethyl-(2,3-dimethylbutan-2-yloxy)phosphinic acid |
| SMILES | COCCOc1nc(N)c2nc(Br)n(CCOCP(=O)(O)OC(C)(C)C(C)C)c2n1 |
| InChI | InChI=1S/C17H29BrN5O6P/c1-11(2)17(3,4)29-30(24,25)10-27-7-6-23-14-12(20-15(23)18)13(19)21-16(22-14)28-9-8-26-5/h11H,6-10H2,1-5H3,(H,24,25)(H2,19,21,22) |
| InChIKey | ANYKYIFWOLMVRJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|