C18H24ClN5O3 — CID 143428445
9-[(3Z,5E)-5-(chloromethyl)-2-methylidenehepta-3,5-dienyl]-8-methoxy-2-(2-methoxyethoxy)purin-6-amine (PubChem CID 143428445) has the molecular formula C18H24ClN5O3 and a molecular weight of 393.88 g/mol. Its IUPAC name is 9-[(3Z,5E)-5-(chloromethyl)-2-methylidenehepta-3,5-dienyl]-8-methoxy-2-(2-methoxyethoxy)purin-6-amine.
| Compound Name | 9-[(3Z,5E)-5-(chloromethyl)-2-methylidenehepta-3,5-dienyl]-8-methoxy-2-(2-methoxyethoxy)purin-6-amine |
|---|---|
| PubChem CID | 143428445 |
| Molecular Formula | C18H24ClN5O3 |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 9-[(3Z,5E)-5-(chloromethyl)-2-methylidenehepta-3,5-dienyl]-8-methoxy-2-(2-methoxyethoxy)purin-6-amine |
| SMILES | C=C(/C=C\C(=C/C)CCl)Cn1c(OC)nc2c(N)nc(OCCOC)nc21 |
| InChI | InChI=1S/C18H24ClN5O3/c1-5-13(10-19)7-6-12(2)11-24-16-14(21-18(24)26-4)15(20)22-17(23-16)27-9-8-25-3/h5-7H,2,8-11H2,1,3-4H3,(H2,20,22,23)/b7-6-,13-5+ |
| InChIKey | KFFCGJFFFGOCNE-ZQNRWWJISA-N |
| XLogP | 2.74 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|