C16H24ClN5O5 — CID 143018213
[6-amino-9-ethyl-2-(2-methoxyethoxy)purin-8-yl] 5-chloropentyl carbonate (PubChem CID 143018213) has the molecular formula C16H24ClN5O5 and a molecular weight of 401.85 g/mol. Its IUPAC name is [6-amino-9-ethyl-2-(2-methoxyethoxy)purin-8-yl] 5-chloropentyl carbonate.
| Compound Name | [6-amino-9-ethyl-2-(2-methoxyethoxy)purin-8-yl] 5-chloropentyl carbonate |
|---|---|
| PubChem CID | 143018213 |
| Molecular Formula | C16H24ClN5O5 |
| Molecular Weight | 401.85 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | [6-amino-9-ethyl-2-(2-methoxyethoxy)purin-8-yl] 5-chloropentyl carbonate |
| SMILES | CCn1c(OC(=O)OCCCCCCl)nc2c(N)nc(OCCOC)nc21 |
| InChI | InChI=1S/C16H24ClN5O5/c1-3-22-13-11(12(18)20-14(21-13)25-10-9-24-2)19-15(22)27-16(23)26-8-6-4-5-7-17/h3-10H2,1-2H3,(H2,18,20,21) |
| InChIKey | HOHXWIJQULOPBK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.85 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|